About 1-(3,3-difluoro-4-methoxypyrrolidin-1-yl)-2-hydroxypropan-1-one;ethane
1-(3,3-difluoro-4-methoxypyrrolidin-1-yl)-2-hydroxypropan-1-one;ethane (PubChem CID 145052480) has the molecular formula C10H19F2NO3
and a molecular weight of 239.26 g/mol. Its IUPAC name is 1-(3,3-difluoro-4-methoxypyrrolidin-1-yl)-2-hydroxypropan-1-one;ethane.
Molecular Properties
| Compound Name | 1-(3,3-difluoro-4-methoxypyrrolidin-1-yl)-2-hydroxypropan-1-one;ethane |
| PubChem CID | 145052480 |
| Molecular Formula | C10H19F2NO3 |
| Molecular Weight | 239.26 g/mol |
| Exact Mass | 239.13 |
| IUPAC Name | 1-(3,3-difluoro-4-methoxypyrrolidin-1-yl)-2-hydroxypropan-1-one;ethane |
| SMILES | CC.COC1CN(C(=O)C(C)O)CC1(F)F |
| InChI | InChI=1S/C8H13F2NO3.C2H6/c1-5(12)7(13)11-3-6(14-2)8(9,10)4-11;1-2/h5-6,12H,3-4H2,1-2H3;1-2H3 |
| InChIKey | HEBPEDWQXKXHGS-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.26 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(3,3-difluoro-4-methoxypyrrolidin-1-yl)-2-hydroxypropan-1-one;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3,3-difluoro-4-methoxypyrrolidin-1-yl)-2-hydroxypropan-1-one;ethane?
The IUPAC name of 1-(3,3-difluoro-4-methoxypyrrolidin-1-yl)-2-hydroxypropan-1-one;ethane (CID 145052480) is 1-(3,3-difluoro-4-methoxypyrrolidin-1-yl)-2-hydroxypropan-1-one;ethane.
What is the SMILES notation for 1-(3,3-difluoro-4-methoxypyrrolidin-1-yl)-2-hydroxypropan-1-one;ethane?
The canonical SMILES for 1-(3,3-difluoro-4-methoxypyrrolidin-1-yl)-2-hydroxypropan-1-one;ethane is CC.COC1CN(C(=O)C(C)O)CC1(F)F.
What is the InChIKey of 1-(3,3-difluoro-4-methoxypyrrolidin-1-yl)-2-hydroxypropan-1-one;ethane?
The InChIKey is HEBPEDWQXKXHGS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13F2NO3.C2H6/c1-5(12)7(13)11-3-6(14-2)8(9,10)4-11;1-2/h5-6,12H,3-4H2,1-2H3;1-2H3.
What are the key properties of 1-(3,3-difluoro-4-methoxypyrrolidin-1-yl)-2-hydroxypropan-1-one;ethane?
1-(3,3-difluoro-4-methoxypyrrolidin-1-yl)-2-hydroxypropan-1-one;ethane has a molecular weight of 239.26 g/mol, XLogP of 0.89, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3,3-difluoro-4-methoxypyrrolidin-1-yl)-2-hydroxypropan-1-one;ethane is sourced from PubChem (CID 145052480), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).