C8H12F2INO3 — CID 121246905
[(4S)-3,3-difluoro-1-[(2S)-2-hydroxypropanoyl]piperidin-4-yl] hypoiodite (PubChem CID 121246905) has the molecular formula C8H12F2INO3 and a molecular weight of 335.09 g/mol. Its IUPAC name is [(4S)-3,3-difluoro-1-[(2S)-2-hydroxypropanoyl]piperidin-4-yl] hypoiodite.
| Compound Name | [(4S)-3,3-difluoro-1-[(2S)-2-hydroxypropanoyl]piperidin-4-yl] hypoiodite |
|---|---|
| PubChem CID | 121246905 |
| Molecular Formula | C8H12F2INO3 |
| Molecular Weight | 335.09 g/mol |
| Exact Mass | 334.98 |
| IUPAC Name | [(4S)-3,3-difluoro-1-[(2S)-2-hydroxypropanoyl]piperidin-4-yl] hypoiodite |
| SMILES | C[C@H](O)C(=O)N1CC[C@H](OI)C(F)(F)C1 |
| InChI | InChI=1S/C8H12F2INO3/c1-5(13)7(14)12-3-2-6(15-11)8(9,10)4-12/h5-6,13H,2-4H2,1H3/t5-,6-/m0/s1 |
| InChIKey | DQVUTOHEYVKSMY-WDSKDSINSA-N |
| XLogP | 0.97 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.09 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|