C25H24ClFN6O3 — CID 145053246
(E)-N-[3-chloro-4-(3-fluoro-4-methoxyanilino)-7-methoxycinnolin-6-yl]-4-(2-methyl-4H-pyrimidin-3-yl)but-2-enamide (PubChem CID 145053246) has the molecular formula C25H24ClFN6O3 and a molecular weight of 510.96 g/mol. Its IUPAC name is (E)-N-[3-chloro-4-(3-fluoro-4-methoxyanilino)-7-methoxycinnolin-6-yl]-4-(2-methyl-4H-pyrimidin-3-yl)but-2-enamide.
| Compound Name | (E)-N-[3-chloro-4-(3-fluoro-4-methoxyanilino)-7-methoxycinnolin-6-yl]-4-(2-methyl-4H-pyrimidin-3-yl)but-2-enamide |
|---|---|
| PubChem CID | 145053246 |
| Molecular Formula | C25H24ClFN6O3 |
| Molecular Weight | 510.96 g/mol |
| Exact Mass | 510.16 |
| IUPAC Name | (E)-N-[3-chloro-4-(3-fluoro-4-methoxyanilino)-7-methoxycinnolin-6-yl]-4-(2-methyl-4H-pyrimidin-3-yl)but-2-enamide |
| SMILES | COc1ccc(Nc2c(Cl)nnc3cc(OC)c(NC(=O)/C=C/CN4CC=CN=C4C)cc23)cc1F |
| InChI | InChI=1S/C25H24ClFN6O3/c1-15-28-9-5-11-33(15)10-4-6-23(34)30-20-13-17-19(14-22(20)36-3)31-32-25(26)24(17)29-16-7-8-21(35-2)18(27)12-16/h4-9,12-14H,10-11H2,1-3H3,(H,29,31)(H,30,34)/b6-4+ |
| InChIKey | OXXTYXAZDYOSRD-GQCTYLIASA-N |
| XLogP | 4.93 |
| TPSA | 100.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.96 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|