About N,N-dimethylmorpholine-4-carboximidamide;ethane
N,N-dimethylmorpholine-4-carboximidamide;ethane (PubChem CID 145053354) has the molecular formula C9H21N3O
and a molecular weight of 187.29 g/mol. Its IUPAC name is N,N-dimethylmorpholine-4-carboximidamide;ethane.
Molecular Properties
| Compound Name | N,N-dimethylmorpholine-4-carboximidamide;ethane |
| PubChem CID | 145053354 |
| Molecular Formula | C9H21N3O |
| Molecular Weight | 187.29 g/mol |
| Exact Mass | 187.17 |
| IUPAC Name | N,N-dimethylmorpholine-4-carboximidamide;ethane |
| SMILES | CC.[H]/N=C(\N(C)C)N1CCOCC1 |
| InChI | InChI=1S/C7H15N3O.C2H6/c1-9(2)7(8)10-3-5-11-6-4-10;1-2/h8H,3-6H2,1-2H3;1-2H3/b8-7+; |
| InChIKey | BAPTVFKIOKYMFE-USRGLUTNSA-N |
| XLogP | 0.84 |
| TPSA | 39.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.29 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N,N-dimethylmorpholine-4-carboximidamide;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethylmorpholine-4-carboximidamide;ethane?
The IUPAC name of N,N-dimethylmorpholine-4-carboximidamide;ethane (CID 145053354) is N,N-dimethylmorpholine-4-carboximidamide;ethane.
What is the SMILES notation for N,N-dimethylmorpholine-4-carboximidamide;ethane?
The canonical SMILES for N,N-dimethylmorpholine-4-carboximidamide;ethane is CC.[H]/N=C(\N(C)C)N1CCOCC1.
What is the InChIKey of N,N-dimethylmorpholine-4-carboximidamide;ethane?
The InChIKey is BAPTVFKIOKYMFE-USRGLUTNSA-N. The full InChI is InChI=1S/C7H15N3O.C2H6/c1-9(2)7(8)10-3-5-11-6-4-10;1-2/h8H,3-6H2,1-2H3;1-2H3/b8-7+;.
What are the key properties of N,N-dimethylmorpholine-4-carboximidamide;ethane?
N,N-dimethylmorpholine-4-carboximidamide;ethane has a molecular weight of 187.29 g/mol, XLogP of 0.84, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethylmorpholine-4-carboximidamide;ethane is sourced from PubChem (CID 145053354), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).