C33H28N4O5 — CID 145054985
2-[(1Z,3E)-1-amino-3-carboxypenta-1,3-dienyl]-6-[4-[5-(N-phenylanilino)furan-2-yl]-1,2-dihydropyridin-2-yl]pyridine-4-carboxylic acid (PubChem CID 145054985) has the molecular formula C33H28N4O5 and a molecular weight of 560.61 g/mol. Its IUPAC name is 2-[(1Z,3E)-1-amino-3-carboxypenta-1,3-dienyl]-6-[4-[5-(N-phenylanilino)furan-2-yl]-1,2-dihydropyridin-2-yl]pyridine-4-carboxylic acid.
| Compound Name | 2-[(1Z,3E)-1-amino-3-carboxypenta-1,3-dienyl]-6-[4-[5-(N-phenylanilino)furan-2-yl]-1,2-dihydropyridin-2-yl]pyridine-4-carboxylic acid |
|---|---|
| PubChem CID | 145054985 |
| Molecular Formula | C33H28N4O5 |
| Molecular Weight | 560.61 g/mol |
| Exact Mass | 560.21 |
| IUPAC Name | 2-[(1Z,3E)-1-amino-3-carboxypenta-1,3-dienyl]-6-[4-[5-(N-phenylanilino)furan-2-yl]-1,2-dihydropyridin-2-yl]pyridine-4-carboxylic acid |
| SMILES | C/C=C(\C=C(/N)c1cc(C(=O)O)cc(C2C=C(c3ccc(N(c4ccccc4)c4ccccc4)o3)C=CN2)n1)C(=O)O |
| InChI | InChI=1S/C33H28N4O5/c1-2-21(32(38)39)17-26(34)27-19-23(33(40)41)20-29(36-27)28-18-22(15-16-35-28)30-13-14-31(42-30)37(24-9-5-3-6-10-24)25-11-7-4-8-12-25/h2-20,28,35H,34H2,1H3,(H,38,39)(H,40,41)/b21-2+,26-17- |
| InChIKey | VRTQITXDNVIQQD-LCJGEEPTSA-N |
| XLogP | 6.41 |
| TPSA | 141.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.61 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|