C26H26F6N2O2 — CID 145056586
methyl N-[(Z)-1-[3-(trifluoromethyl)-4-[(E)-3-[2-(trifluoromethyl)phenyl]prop-2-enoxy]phenyl]prop-1-enyl]pyrrolidine-2-carboximidate (PubChem CID 145056586) has the molecular formula C26H26F6N2O2 and a molecular weight of 512.49 g/mol. Its IUPAC name is methyl N-[(Z)-1-[3-(trifluoromethyl)-4-[(E)-3-[2-(trifluoromethyl)phenyl]prop-2-enoxy]phenyl]prop-1-enyl]pyrrolidine-2-carboximidate.
| Compound Name | methyl N-[(Z)-1-[3-(trifluoromethyl)-4-[(E)-3-[2-(trifluoromethyl)phenyl]prop-2-enoxy]phenyl]prop-1-enyl]pyrrolidine-2-carboximidate |
|---|---|
| PubChem CID | 145056586 |
| Molecular Formula | C26H26F6N2O2 |
| Molecular Weight | 512.49 g/mol |
| Exact Mass | 512.19 |
| IUPAC Name | methyl N-[(Z)-1-[3-(trifluoromethyl)-4-[(E)-3-[2-(trifluoromethyl)phenyl]prop-2-enoxy]phenyl]prop-1-enyl]pyrrolidine-2-carboximidate |
| SMILES | C/C=C(\N=C(/OC)C1CCCN1)c1ccc(OC/C=C/c2ccccc2C(F)(F)F)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C26H26F6N2O2/c1-3-21(34-24(35-2)22-11-6-14-33-22)18-12-13-23(20(16-18)26(30,31)32)36-15-7-9-17-8-4-5-10-19(17)25(27,28)29/h3-5,7-10,12-13,16,22,33H,6,11,14-15H2,1-2H3/b9-7+,21-3-,34-24- |
| InChIKey | NWYWKFFBYIQXLW-VARGNFIXSA-N |
| XLogP | 6.97 |
| TPSA | 42.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.49 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|