C18H18F3NO — CID 21364516
2-[5-methyl-2-[4-(trifluoromethyl)phenoxy]phenyl]pyrrolidine (PubChem CID 21364516) has the molecular formula C18H18F3NO and a molecular weight of 321.34 g/mol. Its IUPAC name is 2-[5-methyl-2-[4-(trifluoromethyl)phenoxy]phenyl]pyrrolidine.
| Compound Name | 2-[5-methyl-2-[4-(trifluoromethyl)phenoxy]phenyl]pyrrolidine |
|---|---|
| PubChem CID | 21364516 |
| Molecular Formula | C18H18F3NO |
| Molecular Weight | 321.34 g/mol |
| Exact Mass | 321.13 |
| IUPAC Name | 2-[5-methyl-2-[4-(trifluoromethyl)phenoxy]phenyl]pyrrolidine |
| SMILES | Cc1ccc(Oc2ccc(C(F)(F)F)cc2)c(C2CCCN2)c1 |
| InChI | InChI=1S/C18H18F3NO/c1-12-4-9-17(15(11-12)16-3-2-10-22-16)23-14-7-5-13(6-8-14)18(19,20)21/h4-9,11,16,22H,2-3,10H2,1H3 |
| InChIKey | FLVXNMOJUDJUMV-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.34 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |