C22H17FN4 — CID 145057336
2-ethyl-3-(3-fluorophenyl)-5-[2-(1-methylpyrazol-4-yl)ethynyl]quinoxaline (PubChem CID 145057336) has the molecular formula C22H17FN4 and a molecular weight of 356.40 g/mol. Its IUPAC name is 2-ethyl-3-(3-fluorophenyl)-5-[2-(1-methylpyrazol-4-yl)ethynyl]quinoxaline.
| Compound Name | 2-ethyl-3-(3-fluorophenyl)-5-[2-(1-methylpyrazol-4-yl)ethynyl]quinoxaline |
|---|---|
| PubChem CID | 145057336 |
| Molecular Formula | C22H17FN4 |
| Molecular Weight | 356.40 g/mol |
| Exact Mass | 356.14 |
| IUPAC Name | 2-ethyl-3-(3-fluorophenyl)-5-[2-(1-methylpyrazol-4-yl)ethynyl]quinoxaline |
| SMILES | CCc1nc2cccc(C#Cc3cnn(C)c3)c2nc1-c1cccc(F)c1 |
| InChI | InChI=1S/C22H17FN4/c1-3-19-22(17-7-4-8-18(23)12-17)26-21-16(6-5-9-20(21)25-19)11-10-15-13-24-27(2)14-15/h4-9,12-14H,3H2,1-2H3 |
| InChIKey | JZMMTZNUQSPBDC-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.40 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|