C21H17N3S — CID 145057345
6-ethyl-3-[2-(1-methylpyrazol-4-yl)ethynyl]-5-phenylthieno[3,2-b]pyridine (PubChem CID 145057345) has the molecular formula C21H17N3S and a molecular weight of 343.46 g/mol. Its IUPAC name is 6-ethyl-3-[2-(1-methylpyrazol-4-yl)ethynyl]-5-phenylthieno[3,2-b]pyridine.
| Compound Name | 6-ethyl-3-[2-(1-methylpyrazol-4-yl)ethynyl]-5-phenylthieno[3,2-b]pyridine |
|---|---|
| PubChem CID | 145057345 |
| Molecular Formula | C21H17N3S |
| Molecular Weight | 343.46 g/mol |
| Exact Mass | 343.11 |
| IUPAC Name | 6-ethyl-3-[2-(1-methylpyrazol-4-yl)ethynyl]-5-phenylthieno[3,2-b]pyridine |
| SMILES | CCc1cc2scc(C#Cc3cnn(C)c3)c2nc1-c1ccccc1 |
| InChI | InChI=1S/C21H17N3S/c1-3-16-11-19-21(23-20(16)17-7-5-4-6-8-17)18(14-25-19)10-9-15-12-22-24(2)13-15/h4-8,11-14H,3H2,1-2H3 |
| InChIKey | BWODFPULKYWPLE-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.46 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|