C24H25FN4O5 — CID 145057806
5-N-[1-[4-(4-fluorophenyl)phenyl]ethyl]-6-oxo-2-N-(3-oxopropyl)-1H-pyrimidine-2,5-dicarboxamide;methanol (PubChem CID 145057806) has the molecular formula C24H25FN4O5 and a molecular weight of 468.49 g/mol. Its IUPAC name is 5-N-[1-[4-(4-fluorophenyl)phenyl]ethyl]-6-oxo-2-N-(3-oxopropyl)-1H-pyrimidine-2,5-dicarboxamide;methanol.
| Compound Name | 5-N-[1-[4-(4-fluorophenyl)phenyl]ethyl]-6-oxo-2-N-(3-oxopropyl)-1H-pyrimidine-2,5-dicarboxamide;methanol |
|---|---|
| PubChem CID | 145057806 |
| Molecular Formula | C24H25FN4O5 |
| Molecular Weight | 468.49 g/mol |
| Exact Mass | 468.18 |
| IUPAC Name | 5-N-[1-[4-(4-fluorophenyl)phenyl]ethyl]-6-oxo-2-N-(3-oxopropyl)-1H-pyrimidine-2,5-dicarboxamide;methanol |
| SMILES | CC(NC(=O)c1cnc(C(=O)NCCC=O)[nH]c1=O)c1ccc(-c2ccc(F)cc2)cc1.CO |
| InChI | InChI=1S/C23H21FN4O4.CH4O/c1-14(15-3-5-16(6-4-15)17-7-9-18(24)10-8-17)27-21(30)19-13-26-20(28-22(19)31)23(32)25-11-2-12-29;1-2/h3-10,12-14H,2,11H2,1H3,(H,25,32)(H,27,30)(H,26,28,31);2H,1H3 |
| InChIKey | SEIHKELWFWEAGQ-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 141.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.49 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|