C12H26N2O2S2 — CID 145061866
N-[2-(2-aminoethyldisulfanyl)ethyl]formamide;2-methylhexan-3-one (PubChem CID 145061866) has the molecular formula C12H26N2O2S2 and a molecular weight of 294.49 g/mol. Its IUPAC name is N-[2-(2-aminoethyldisulfanyl)ethyl]formamide;2-methylhexan-3-one.
| Compound Name | N-[2-(2-aminoethyldisulfanyl)ethyl]formamide;2-methylhexan-3-one |
|---|---|
| PubChem CID | 145061866 |
| Molecular Formula | C12H26N2O2S2 |
| Molecular Weight | 294.49 g/mol |
| Exact Mass | 294.14 |
| IUPAC Name | N-[2-(2-aminoethyldisulfanyl)ethyl]formamide;2-methylhexan-3-one |
| SMILES | CCCC(=O)C(C)C.NCCSSCCNC=O |
| InChI | InChI=1S/C7H14O.C5H12N2OS2/c1-4-5-7(8)6(2)3;6-1-3-9-10-4-2-7-5-8/h6H,4-5H2,1-3H3;5H,1-4,6H2,(H,7,8) |
| InChIKey | IRROCURZSGKWKG-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.49 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|