C12H26N2O3 — CID 87695548
(2S)-2-aminopropanoic acid;N-octylformamide (PubChem CID 87695548) has the molecular formula C12H26N2O3 and a molecular weight of 246.35 g/mol. Its IUPAC name is (2S)-2-aminopropanoic acid;N-octylformamide.
| Compound Name | (2S)-2-aminopropanoic acid;N-octylformamide |
|---|---|
| PubChem CID | 87695548 |
| Molecular Formula | C12H26N2O3 |
| Molecular Weight | 246.35 g/mol |
| Exact Mass | 246.19 |
| IUPAC Name | (2S)-2-aminopropanoic acid;N-octylformamide |
| SMILES | CCCCCCCCNC=O.C[C@H](N)C(=O)O |
| InChI | InChI=1S/C9H19NO.C3H7NO2/c1-2-3-4-5-6-7-8-10-9-11;1-2(4)3(5)6/h9H,2-8H2,1H3,(H,10,11);2H,4H2,1H3,(H,5,6)/t;2-/m.0/s1 |
| InChIKey | AQUPGOICGFHVRJ-WNQIDUERSA-N |
| XLogP | 1.51 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.35 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|