About tris(2-aminoethanol);2-(dodecylamino)propanoic acid
tris(2-aminoethanol);2-(dodecylamino)propanoic acid (PubChem CID 173055102) has the molecular formula C21H52N4O5
and a molecular weight of 440.67 g/mol. Its IUPAC name is tris(2-aminoethanol);2-(dodecylamino)propanoic acid.
Molecular Properties
| Compound Name | tris(2-aminoethanol);2-(dodecylamino)propanoic acid |
| PubChem CID | 173055102 |
| Molecular Formula | C21H52N4O5 |
| Molecular Weight | 440.67 g/mol |
| Exact Mass | 440.39 |
| IUPAC Name | tris(2-aminoethanol);2-(dodecylamino)propanoic acid |
| SMILES | CCCCCCCCCCCCNC(C)C(=O)O.NCCO.NCCO.NCCO |
| InChI | InChI=1S/C15H31NO2.3C2H7NO/c1-3-4-5-6-7-8-9-10-11-12-13-16-14(2)15(17)18;3*3-1-2-4/h14,16H,3-13H2,1-2H3,(H,17,18);3*4H,1-3H2 |
| InChIKey | SEWUIKPYXQAAIB-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 188.08 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 440.67 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze tris(2-aminoethanol);2-(dodecylamino)propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tris(2-aminoethanol);2-(dodecylamino)propanoic acid?
The IUPAC name of tris(2-aminoethanol);2-(dodecylamino)propanoic acid (CID 173055102) is tris(2-aminoethanol);2-(dodecylamino)propanoic acid.
What is the SMILES notation for tris(2-aminoethanol);2-(dodecylamino)propanoic acid?
The canonical SMILES for tris(2-aminoethanol);2-(dodecylamino)propanoic acid is CCCCCCCCCCCCNC(C)C(=O)O.NCCO.NCCO.NCCO.
What is the InChIKey of tris(2-aminoethanol);2-(dodecylamino)propanoic acid?
The InChIKey is SEWUIKPYXQAAIB-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H31NO2.3C2H7NO/c1-3-4-5-6-7-8-9-10-11-12-13-16-14(2)15(17)18;3*3-1-2-4/h14,16H,3-13H2,1-2H3,(H,17,18);3*4H,1-3H2.
What are the key properties of tris(2-aminoethanol);2-(dodecylamino)propanoic acid?
tris(2-aminoethanol);2-(dodecylamino)propanoic acid has a molecular weight of 440.67 g/mol, XLogP of 0.78, 16 rotatable bonds, 8 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for tris(2-aminoethanol);2-(dodecylamino)propanoic acid is sourced from PubChem (CID 173055102), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).