About 2-(pentylamino)propanoic acid
2-(pentylamino)propanoic acid (PubChem CID 43467235) has the molecular formula C8H17NO2
and a molecular weight of 159.23 g/mol. Its IUPAC name is 2-(pentylamino)propanoic acid.
Molecular Properties
| Compound Name | 2-(pentylamino)propanoic acid |
| PubChem CID | 43467235 |
| Molecular Formula | C8H17NO2 |
| Molecular Weight | 159.23 g/mol |
| Exact Mass | 159.13 |
| IUPAC Name | 2-(pentylamino)propanoic acid |
| SMILES | CCCCCNC(C)C(=O)O |
| InChI | InChI=1S/C8H17NO2/c1-3-4-5-6-9-7(2)8(10)11/h7,9H,3-6H2,1-2H3,(H,10,11) |
| InChIKey | QHRHSDCXMKAXDH-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.23 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-(pentylamino)propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(pentylamino)propanoic acid?
The IUPAC name of 2-(pentylamino)propanoic acid (CID 43467235) is 2-(pentylamino)propanoic acid.
What is the SMILES notation for 2-(pentylamino)propanoic acid?
The canonical SMILES for 2-(pentylamino)propanoic acid is CCCCCNC(C)C(=O)O.
What is the InChIKey of 2-(pentylamino)propanoic acid?
The InChIKey is QHRHSDCXMKAXDH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17NO2/c1-3-4-5-6-9-7(2)8(10)11/h7,9H,3-6H2,1-2H3,(H,10,11).
What are the key properties of 2-(pentylamino)propanoic acid?
2-(pentylamino)propanoic acid has a molecular weight of 159.23 g/mol, XLogP of 1.24, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(pentylamino)propanoic acid is sourced from PubChem (CID 43467235), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).