C17H27ClN4O — CID 145062148
(3E,5E,6Z)-8-chloro-5-ethylidene-2-methanimidoyl-3-N-(2-morpholin-4-ylethyl)octa-1,3,6-triene-3,6-diamine (PubChem CID 145062148) has the molecular formula C17H27ClN4O and a molecular weight of 338.88 g/mol. Its IUPAC name is (3E,5E,6Z)-8-chloro-5-ethylidene-2-methanimidoyl-3-N-(2-morpholin-4-ylethyl)octa-1,3,6-triene-3,6-diamine.
| Compound Name | (3E,5E,6Z)-8-chloro-5-ethylidene-2-methanimidoyl-3-N-(2-morpholin-4-ylethyl)octa-1,3,6-triene-3,6-diamine |
|---|---|
| PubChem CID | 145062148 |
| Molecular Formula | C17H27ClN4O |
| Molecular Weight | 338.88 g/mol |
| Exact Mass | 338.19 |
| IUPAC Name | (3E,5E,6Z)-8-chloro-5-ethylidene-2-methanimidoyl-3-N-(2-morpholin-4-ylethyl)octa-1,3,6-triene-3,6-diamine |
| SMILES | [H]/N=C/C(=C)/C(=C\C(=C/C)\C(N)=C\CCl)NCCN1CCOCC1 |
| InChI | InChI=1S/C17H27ClN4O/c1-3-15(16(20)4-5-18)12-17(14(2)13-19)21-6-7-22-8-10-23-11-9-22/h3-4,12-13,19,21H,2,5-11,20H2,1H3/b15-3+,16-4-,17-12+,19-13+ |
| InChIKey | WHYUMNQXBYZAGY-SXEZUFMRSA-N |
| XLogP | 2.03 |
| TPSA | 74.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.88 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|