C18H30N4O — CID 145062250
(3E,5E,6Z)-5-ethylidene-2-methanimidoyl-3-N-(2-morpholin-4-ylethyl)nona-1,3,6-triene-3,6-diamine (PubChem CID 145062250) has the molecular formula C18H30N4O and a molecular weight of 318.47 g/mol. Its IUPAC name is (3E,5E,6Z)-5-ethylidene-2-methanimidoyl-3-N-(2-morpholin-4-ylethyl)nona-1,3,6-triene-3,6-diamine.
| Compound Name | (3E,5E,6Z)-5-ethylidene-2-methanimidoyl-3-N-(2-morpholin-4-ylethyl)nona-1,3,6-triene-3,6-diamine |
|---|---|
| PubChem CID | 145062250 |
| Molecular Formula | C18H30N4O |
| Molecular Weight | 318.47 g/mol |
| Exact Mass | 318.24 |
| IUPAC Name | (3E,5E,6Z)-5-ethylidene-2-methanimidoyl-3-N-(2-morpholin-4-ylethyl)nona-1,3,6-triene-3,6-diamine |
| SMILES | [H]/N=C/C(=C)/C(=C\C(=C/C)\C(N)=C\CC)NCCN1CCOCC1 |
| InChI | InChI=1S/C18H30N4O/c1-4-6-17(20)16(5-2)13-18(15(3)14-19)21-7-8-22-9-11-23-12-10-22/h5-6,13-14,19,21H,3-4,7-12,20H2,1-2H3/b16-5+,17-6-,18-13+,19-14+ |
| InChIKey | BNSYWMOOSMUFBF-RQCIWKLYSA-N |
| XLogP | 2.20 |
| TPSA | 74.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.47 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|