C19H31N3O — CID 143721918
(2E,4E,6Z)-N,3-dimethyl-2-(3-methylbut-3-en-2-ylideneamino)-1-morpholin-4-ylocta-2,4,6-trien-4-amine (PubChem CID 143721918) has the molecular formula C19H31N3O and a molecular weight of 317.48 g/mol. Its IUPAC name is (2E,4E,6Z)-N,3-dimethyl-2-(3-methylbut-3-en-2-ylideneamino)-1-morpholin-4-ylocta-2,4,6-trien-4-amine.
| Compound Name | (2E,4E,6Z)-N,3-dimethyl-2-(3-methylbut-3-en-2-ylideneamino)-1-morpholin-4-ylocta-2,4,6-trien-4-amine |
|---|---|
| PubChem CID | 143721918 |
| Molecular Formula | C19H31N3O |
| Molecular Weight | 317.48 g/mol |
| Exact Mass | 317.25 |
| IUPAC Name | (2E,4E,6Z)-N,3-dimethyl-2-(3-methylbut-3-en-2-ylideneamino)-1-morpholin-4-ylocta-2,4,6-trien-4-amine |
| SMILES | C=C(C)/C(C)=N/C(CN1CCOCC1)=C(C)/C(=C\C=C/C)NC |
| InChI | InChI=1S/C19H31N3O/c1-7-8-9-18(20-6)16(4)19(21-17(5)15(2)3)14-22-10-12-23-13-11-22/h7-9,20H,2,10-14H2,1,3-6H3/b8-7-,18-9+,19-16+,21-17+ |
| InChIKey | QYGHPDLASHATCL-DUXMRWRNSA-N |
| XLogP | 3.31 |
| TPSA | 36.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.48 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|