C17H28N4O2 — CID 145062579
N-(1-formylpyrrolidin-3-yl)-2-methylcyclopropane-1-carboxamide;5-methyl-3-propan-2-yl-1H-pyrazole (PubChem CID 145062579) has the molecular formula C17H28N4O2 and a molecular weight of 320.44 g/mol. Its IUPAC name is N-(1-formylpyrrolidin-3-yl)-2-methylcyclopropane-1-carboxamide;5-methyl-3-propan-2-yl-1H-pyrazole.
| Compound Name | N-(1-formylpyrrolidin-3-yl)-2-methylcyclopropane-1-carboxamide;5-methyl-3-propan-2-yl-1H-pyrazole |
|---|---|
| PubChem CID | 145062579 |
| Molecular Formula | C17H28N4O2 |
| Molecular Weight | 320.44 g/mol |
| Exact Mass | 320.22 |
| IUPAC Name | N-(1-formylpyrrolidin-3-yl)-2-methylcyclopropane-1-carboxamide;5-methyl-3-propan-2-yl-1H-pyrazole |
| SMILES | CC1CC1C(=O)NC1CCN(C=O)C1.Cc1cc(C(C)C)n[nH]1 |
| InChI | InChI=1S/C10H16N2O2.C7H12N2/c1-7-4-9(7)10(14)11-8-2-3-12(5-8)6-13;1-5(2)7-4-6(3)8-9-7/h6-9H,2-5H2,1H3,(H,11,14);4-5H,1-3H3,(H,8,9) |
| InChIKey | OOJDOPSKADXWHH-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 78.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.44 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|