C17H28N4O3 — CID 145062801
N-[1-[hydroxy-(3-propan-2-yl-1H-pyrazol-5-yl)methyl]pyrrolidin-3-yl]oxane-4-carboxamide (PubChem CID 145062801) has the molecular formula C17H28N4O3 and a molecular weight of 336.44 g/mol. Its IUPAC name is N-[1-[hydroxy-(3-propan-2-yl-1H-pyrazol-5-yl)methyl]pyrrolidin-3-yl]oxane-4-carboxamide.
| Compound Name | N-[1-[hydroxy-(3-propan-2-yl-1H-pyrazol-5-yl)methyl]pyrrolidin-3-yl]oxane-4-carboxamide |
|---|---|
| PubChem CID | 145062801 |
| Molecular Formula | C17H28N4O3 |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.22 |
| IUPAC Name | N-[1-[hydroxy-(3-propan-2-yl-1H-pyrazol-5-yl)methyl]pyrrolidin-3-yl]oxane-4-carboxamide |
| SMILES | CC(C)c1cc(C(O)N2CCC(NC(=O)C3CCOCC3)C2)[nH]n1 |
| InChI | InChI=1S/C17H28N4O3/c1-11(2)14-9-15(20-19-14)17(23)21-6-3-13(10-21)18-16(22)12-4-7-24-8-5-12/h9,11-13,17,23H,3-8,10H2,1-2H3,(H,18,22)(H,19,20) |
| InChIKey | WCDWZWYTZZCDLV-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 90.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |