C13H20N4O2 — CID 145062856
N-[1-(5-butan-2-yl-1H-pyrazole-3-carbonyl)pyrrolidin-3-yl]formamide (PubChem CID 145062856) has the molecular formula C13H20N4O2 and a molecular weight of 264.33 g/mol. Its IUPAC name is N-[1-(5-butan-2-yl-1H-pyrazole-3-carbonyl)pyrrolidin-3-yl]formamide.
| Compound Name | N-[1-(5-butan-2-yl-1H-pyrazole-3-carbonyl)pyrrolidin-3-yl]formamide |
|---|---|
| PubChem CID | 145062856 |
| Molecular Formula | C13H20N4O2 |
| Molecular Weight | 264.33 g/mol |
| Exact Mass | 264.16 |
| IUPAC Name | N-[1-(5-butan-2-yl-1H-pyrazole-3-carbonyl)pyrrolidin-3-yl]formamide |
| SMILES | CCC(C)c1cc(C(=O)N2CCC(NC=O)C2)n[nH]1 |
| InChI | InChI=1S/C13H20N4O2/c1-3-9(2)11-6-12(16-15-11)13(19)17-5-4-10(7-17)14-8-18/h6,8-10H,3-5,7H2,1-2H3,(H,14,18)(H,15,16) |
| InChIKey | UCPXSTVGDBLGIW-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 78.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.33 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|