C14H21F3N4O2 — CID 162575493
(5-propan-2-yl-1H-pyrazol-3-yl)-[3-[(3,3,3-trifluoro-1-hydroxypropyl)amino]pyrrolidin-1-yl]methanone (PubChem CID 162575493) has the molecular formula C14H21F3N4O2 and a molecular weight of 334.34 g/mol. Its IUPAC name is (5-propan-2-yl-1H-pyrazol-3-yl)-[3-[(3,3,3-trifluoro-1-hydroxypropyl)amino]pyrrolidin-1-yl]methanone.
| Compound Name | (5-propan-2-yl-1H-pyrazol-3-yl)-[3-[(3,3,3-trifluoro-1-hydroxypropyl)amino]pyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 162575493 |
| Molecular Formula | C14H21F3N4O2 |
| Molecular Weight | 334.34 g/mol |
| Exact Mass | 334.16 |
| IUPAC Name | (5-propan-2-yl-1H-pyrazol-3-yl)-[3-[(3,3,3-trifluoro-1-hydroxypropyl)amino]pyrrolidin-1-yl]methanone |
| SMILES | CC(C)c1cc(C(=O)N2CCC(NC(O)CC(F)(F)F)C2)n[nH]1 |
| InChI | InChI=1S/C14H21F3N4O2/c1-8(2)10-5-11(20-19-10)13(23)21-4-3-9(7-21)18-12(22)6-14(15,16)17/h5,8-9,12,18,22H,3-4,6-7H2,1-2H3,(H,19,20) |
| InChIKey | MVBZFTSEBLQKTH-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 81.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.34 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|