C10H12BrFN2 — CID 145062948
4-[(1E,3E)-3-bromo-1-fluoropenta-1,3-dienyl]-1,5-dimethylpyrazole (PubChem CID 145062948) has the molecular formula C10H12BrFN2 and a molecular weight of 259.12 g/mol. Its IUPAC name is 4-[(1E,3E)-3-bromo-1-fluoropenta-1,3-dienyl]-1,5-dimethylpyrazole.
| Compound Name | 4-[(1E,3E)-3-bromo-1-fluoropenta-1,3-dienyl]-1,5-dimethylpyrazole |
|---|---|
| PubChem CID | 145062948 |
| Molecular Formula | C10H12BrFN2 |
| Molecular Weight | 259.12 g/mol |
| Exact Mass | 258.02 |
| IUPAC Name | 4-[(1E,3E)-3-bromo-1-fluoropenta-1,3-dienyl]-1,5-dimethylpyrazole |
| SMILES | C/C=C(Br)\C=C(\F)c1cnn(C)c1C |
| InChI | InChI=1S/C10H12BrFN2/c1-4-8(11)5-10(12)9-6-13-14(3)7(9)2/h4-6H,1-3H3/b8-4+,10-5+ |
| InChIKey | ZGFBTDQBGFEMPN-DXNUHORPSA-N |
| XLogP | 3.34 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.12 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|