C23H19F3N4OS — CID 145063645
5-fluoro-4-(4-fluoro-1-benzofuran-7-yl)-N-[3-fluoro-5-(methylsulfanylmethyl)phenyl]pyrimidin-2-amine;prop-1-yn-1-amine (PubChem CID 145063645) has the molecular formula C23H19F3N4OS and a molecular weight of 456.49 g/mol. Its IUPAC name is 5-fluoro-4-(4-fluoro-1-benzofuran-7-yl)-N-[3-fluoro-5-(methylsulfanylmethyl)phenyl]pyrimidin-2-amine;prop-1-yn-1-amine.
| Compound Name | 5-fluoro-4-(4-fluoro-1-benzofuran-7-yl)-N-[3-fluoro-5-(methylsulfanylmethyl)phenyl]pyrimidin-2-amine;prop-1-yn-1-amine |
|---|---|
| PubChem CID | 145063645 |
| Molecular Formula | C23H19F3N4OS |
| Molecular Weight | 456.49 g/mol |
| Exact Mass | 456.12 |
| IUPAC Name | 5-fluoro-4-(4-fluoro-1-benzofuran-7-yl)-N-[3-fluoro-5-(methylsulfanylmethyl)phenyl]pyrimidin-2-amine;prop-1-yn-1-amine |
| SMILES | CC#CN.CSCc1cc(F)cc(Nc2ncc(F)c(-c3ccc(F)c4ccoc34)n2)c1 |
| InChI | InChI=1S/C20H14F3N3OS.C3H5N/c1-28-10-11-6-12(21)8-13(7-11)25-20-24-9-17(23)18(26-20)15-2-3-16(22)14-4-5-27-19(14)15;1-2-3-4/h2-9H,10H2,1H3,(H,24,25,26);4H2,1H3 |
| InChIKey | GFNUPQPPGKATJL-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 76.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.49 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|