C20H14F6N5S+ — CID 162568405
(cyanoamino)-[[3-[[4-(2,4-difluorophenyl)-5-fluoropyrimidin-2-yl]amino]-5-(trifluoromethyl)phenyl]methyl]-methylsulfanium (PubChem CID 162568405) has the molecular formula C20H14F6N5S+ and a molecular weight of 470.42 g/mol. Its IUPAC name is (cyanoamino)-[[3-[[4-(2,4-difluorophenyl)-5-fluoropyrimidin-2-yl]amino]-5-(trifluoromethyl)phenyl]methyl]-methylsulfanium.
| Compound Name | (cyanoamino)-[[3-[[4-(2,4-difluorophenyl)-5-fluoropyrimidin-2-yl]amino]-5-(trifluoromethyl)phenyl]methyl]-methylsulfanium |
|---|---|
| PubChem CID | 162568405 |
| Molecular Formula | C20H14F6N5S+ |
| Molecular Weight | 470.42 g/mol |
| Exact Mass | 470.09 |
| IUPAC Name | (cyanoamino)-[[3-[[4-(2,4-difluorophenyl)-5-fluoropyrimidin-2-yl]amino]-5-(trifluoromethyl)phenyl]methyl]-methylsulfanium |
| SMILES | C[S+](Cc1cc(Nc2ncc(F)c(-c3ccc(F)cc3F)n2)cc(C(F)(F)F)c1)NC#N |
| InChI | InChI=1S/C20H14F6N5S/c1-32(29-10-27)9-11-4-12(20(24,25)26)6-14(5-11)30-19-28-8-17(23)18(31-19)15-3-2-13(21)7-16(15)22/h2-8,29H,9H2,1H3,(H,28,30,31)/q+1 |
| InChIKey | YLZXFIYNYRNEIL-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 73.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.42 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|