C22H17F6N5O2S — CID 123766690
[[3-[[4-(2,4-difluorophenyl)-5-fluoropyrimidin-2-yl]amino]-5-(trifluoromethyl)phenyl]methylidene-(2-methoxyethyl)-oxo-λ6-sulfanyl]cyanamide (PubChem CID 123766690) has the molecular formula C22H17F6N5O2S and a molecular weight of 529.47 g/mol. Its IUPAC name is [[3-[[4-(2,4-difluorophenyl)-5-fluoropyrimidin-2-yl]amino]-5-(trifluoromethyl)phenyl]methylidene-(2-methoxyethyl)-oxo-λ6-sulfanyl]cyanamide.
| Compound Name | [[3-[[4-(2,4-difluorophenyl)-5-fluoropyrimidin-2-yl]amino]-5-(trifluoromethyl)phenyl]methylidene-(2-methoxyethyl)-oxo-λ6-sulfanyl]cyanamide |
|---|---|
| PubChem CID | 123766690 |
| Molecular Formula | C22H17F6N5O2S |
| Molecular Weight | 529.47 g/mol |
| Exact Mass | 529.10 |
| IUPAC Name | [[3-[[4-(2,4-difluorophenyl)-5-fluoropyrimidin-2-yl]amino]-5-(trifluoromethyl)phenyl]methylidene-(2-methoxyethyl)-oxo-λ6-sulfanyl]cyanamide |
| SMILES | COCCS(=O)(=Cc1cc(Nc2ncc(F)c(-c3ccc(F)cc3F)n2)cc(C(F)(F)F)c1)NC#N |
| InChI | InChI=1S/C22H17F6N5O2S/c1-35-4-5-36(34,31-12-29)11-13-6-14(22(26,27)28)8-16(7-13)32-21-30-10-19(25)20(33-21)17-3-2-15(23)9-18(17)24/h2-3,6-11H,4-5H2,1H3,(H,31,34)(H,30,32,33) |
| InChIKey | HOGFHJCFAICHMM-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 99.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.47 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|