C27H33N5O4 — CID 145066559
7,8-dimethoxy-N,4-dimethyl-1-[4-[(1S,4S)-5-methyl-2,5-diazabicyclo[2.2.1]heptane-2-carbonyl]phenyl]-4,5-dihydro-2,3-benzodiazepine-3-carboxamide (PubChem CID 145066559) has the molecular formula C27H33N5O4 and a molecular weight of 491.59 g/mol. Its IUPAC name is 7,8-dimethoxy-N,4-dimethyl-1-[4-[(1S,4S)-5-methyl-2,5-diazabicyclo[2.2.1]heptane-2-carbonyl]phenyl]-4,5-dihydro-2,3-benzodiazepine-3-carboxamide.
| Compound Name | 7,8-dimethoxy-N,4-dimethyl-1-[4-[(1S,4S)-5-methyl-2,5-diazabicyclo[2.2.1]heptane-2-carbonyl]phenyl]-4,5-dihydro-2,3-benzodiazepine-3-carboxamide |
|---|---|
| PubChem CID | 145066559 |
| Molecular Formula | C27H33N5O4 |
| Molecular Weight | 491.59 g/mol |
| Exact Mass | 491.25 |
| IUPAC Name | 7,8-dimethoxy-N,4-dimethyl-1-[4-[(1S,4S)-5-methyl-2,5-diazabicyclo[2.2.1]heptane-2-carbonyl]phenyl]-4,5-dihydro-2,3-benzodiazepine-3-carboxamide |
| SMILES | CNC(=O)N1N=C(c2ccc(C(=O)N3C[C@@H]4C[C@H]3CN4C)cc2)c2cc(OC)c(OC)cc2CC1C |
| InChI | InChI=1S/C27H33N5O4/c1-16-10-19-11-23(35-4)24(36-5)13-22(19)25(29-32(16)27(34)28-2)17-6-8-18(9-7-17)26(33)31-15-20-12-21(31)14-30(20)3/h6-9,11,13,16,20-21H,10,12,14-15H2,1-5H3,(H,28,34)/t16?,20-,21-/m0/s1 |
| InChIKey | UDUSFZFRAQHUKN-ZMAUEPLISA-N |
| XLogP | 2.57 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.59 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |