C51H38N5- — CID 145067653
7-phenyl-5-[4-[4-phenyl-6-(5-phenylcyclohexa-1,5-dien-1-yl)-1,3-diaza-5-azanidacyclohexa-2,6-dien-2-yl]cyclohexa-1,3-dien-1-yl]indolo[2,3-b]carbazole (PubChem CID 145067653) has the molecular formula C51H38N5- and a molecular weight of 720.90 g/mol. Its IUPAC name is 7-phenyl-5-[4-[4-phenyl-6-(5-phenylcyclohexa-1,5-dien-1-yl)-1,3-diaza-5-azanidacyclohexa-2,6-dien-2-yl]cyclohexa-1,3-dien-1-yl]indolo[2,3-b]carbazole.
| Compound Name | 7-phenyl-5-[4-[4-phenyl-6-(5-phenylcyclohexa-1,5-dien-1-yl)-1,3-diaza-5-azanidacyclohexa-2,6-dien-2-yl]cyclohexa-1,3-dien-1-yl]indolo[2,3-b]carbazole |
|---|---|
| PubChem CID | 145067653 |
| Molecular Formula | C51H38N5- |
| Molecular Weight | 720.90 g/mol |
| Exact Mass | 720.31 |
| IUPAC Name | 7-phenyl-5-[4-[4-phenyl-6-(5-phenylcyclohexa-1,5-dien-1-yl)-1,3-diaza-5-azanidacyclohexa-2,6-dien-2-yl]cyclohexa-1,3-dien-1-yl]indolo[2,3-b]carbazole |
| SMILES | C1=C(C2=NC(C3=CC=C(n4c5ccccc5c5cc6c7ccccc7n(-c7ccccc7)c6cc54)CC3)=NC(c3ccccc3)[N-]2)C=C(c2ccccc2)CC1 |
| InChI | InChI=1S/C51H38N5/c1-4-15-34(16-5-1)37-19-14-20-38(31-37)51-53-49(35-17-6-2-7-18-35)52-50(54-51)36-27-29-40(30-28-36)56-46-26-13-11-24-42(46)44-32-43-41-23-10-12-25-45(41)55(47(43)33-48(44)56)39-21-8-3-9-22-39/h1-13,15-18,20-27,29,31-33,49H,14,19,28,30H2/q-1 |
| InChIKey | BHTZNHWRBBOZED-UHFFFAOYSA-N |
| XLogP | 13.14 |
| TPSA | 48.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 720.90 |
| LogP ≤ 5 | 13.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |