C17H26N2 — CID 145068592
1-(cyclopropylmethyl)-6-methylbenzimidazole;pentane (PubChem CID 145068592) has the molecular formula C17H26N2 and a molecular weight of 258.41 g/mol. Its IUPAC name is 1-(cyclopropylmethyl)-6-methylbenzimidazole;pentane.
| Compound Name | 1-(cyclopropylmethyl)-6-methylbenzimidazole;pentane |
|---|---|
| PubChem CID | 145068592 |
| Molecular Formula | C17H26N2 |
| Molecular Weight | 258.41 g/mol |
| Exact Mass | 258.21 |
| IUPAC Name | 1-(cyclopropylmethyl)-6-methylbenzimidazole;pentane |
| SMILES | CCCCC.Cc1ccc2ncn(CC3CC3)c2c1 |
| InChI | InChI=1S/C12H14N2.C5H12/c1-9-2-5-11-12(6-9)14(8-13-11)7-10-3-4-10;1-3-5-4-2/h2,5-6,8,10H,3-4,7H2,1H3;3-5H2,1-2H3 |
| InChIKey | WUPSSCMGWRNUGO-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.41 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |