About CID 145068992
CID 145068992 (PubChem CID 145068992) has the molecular formula C5H11Sn
and a molecular weight of 189.85 g/mol.
Molecular Properties
| Compound Name | CID 145068992 |
| PubChem CID | 145068992 |
| Molecular Formula | C5H11Sn |
| Molecular Weight | 189.85 g/mol |
| Exact Mass | 190.99 |
| IUPAC Name | — |
| SMILES | CCC(C)(C)[Sn] |
| InChI | InChI=1S/C5H11.Sn/c1-4-5(2)3;/h4H2,1-3H3; |
| InChIKey | JTAAFYBBMMNRKX-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.85 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze CID 145068992 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 145068992?
The IUPAC name of CID 145068992 (CID 145068992) is not available.
What is the SMILES notation for CID 145068992?
The canonical SMILES for CID 145068992 is CCC(C)(C)[Sn].
What is the InChIKey of CID 145068992?
The InChIKey is JTAAFYBBMMNRKX-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11.Sn/c1-4-5(2)3;/h4H2,1-3H3;.
What are the key properties of CID 145068992?
CID 145068992 has a molecular weight of 189.85 g/mol, XLogP of 1.76, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 145068992 is sourced from PubChem (CID 145068992), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).