C22H31NO7S — CID 145069488
[(1R,4aS,5R,8aS)-5-[(2E)-2-[4-(diformylamino)-2-oxooxolan-3-ylidene]ethyl]-1,4a-dimethyl-6-methylidene-3,4,5,7,8,8a-hexahydro-2H-naphthalen-1-yl]methyl hydrogen sulfite (PubChem CID 145069488) has the molecular formula C22H31NO7S and a molecular weight of 453.56 g/mol. Its IUPAC name is [(1R,4aS,5R,8aS)-5-[(2E)-2-[4-(diformylamino)-2-oxooxolan-3-ylidene]ethyl]-1,4a-dimethyl-6-methylidene-3,4,5,7,8,8a-hexahydro-2H-naphthalen-1-yl]methyl hydrogen sulfite.
| Compound Name | [(1R,4aS,5R,8aS)-5-[(2E)-2-[4-(diformylamino)-2-oxooxolan-3-ylidene]ethyl]-1,4a-dimethyl-6-methylidene-3,4,5,7,8,8a-hexahydro-2H-naphthalen-1-yl]methyl hydrogen sulfite |
|---|---|
| PubChem CID | 145069488 |
| Molecular Formula | C22H31NO7S |
| Molecular Weight | 453.56 g/mol |
| Exact Mass | 453.18 |
| IUPAC Name | [(1R,4aS,5R,8aS)-5-[(2E)-2-[4-(diformylamino)-2-oxooxolan-3-ylidene]ethyl]-1,4a-dimethyl-6-methylidene-3,4,5,7,8,8a-hexahydro-2H-naphthalen-1-yl]methyl hydrogen sulfite |
| SMILES | C=C1CC[C@@H]2[C@](C)(COS(=O)O)CCC[C@@]2(C)[C@@H]1C/C=C1/C(=O)OCC1N(C=O)C=O |
| InChI | InChI=1S/C22H31NO7S/c1-15-5-8-19-21(2,12-30-31(27)28)9-4-10-22(19,3)17(15)7-6-16-18(11-29-20(16)26)23(13-24)14-25/h6,13-14,17-19H,1,4-5,7-12H2,2-3H3,(H,27,28)/b16-6+/t17-,18?,19-,21+,22+/m1/s1 |
| InChIKey | JUNJZIKKHAJRLS-WZYHFDLWSA-N |
| XLogP | 2.78 |
| TPSA | 110.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.56 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|