C21H30O4 — CID 157440268
(3E,4S)-3-[2-[(1R,4aS,5S,8aS)-5-ethyl-5,8a-dimethyl-2-methylidene-6-oxo-1,3,4,4a,7,8-hexahydronaphthalen-1-yl]ethylidene]-4-hydroxyoxolan-2-one (PubChem CID 157440268) has the molecular formula C21H30O4 and a molecular weight of 346.47 g/mol. Its IUPAC name is (3E,4S)-3-[2-[(1R,4aS,5S,8aS)-5-ethyl-5,8a-dimethyl-2-methylidene-6-oxo-1,3,4,4a,7,8-hexahydronaphthalen-1-yl]ethylidene]-4-hydroxyoxolan-2-one.
| Compound Name | (3E,4S)-3-[2-[(1R,4aS,5S,8aS)-5-ethyl-5,8a-dimethyl-2-methylidene-6-oxo-1,3,4,4a,7,8-hexahydronaphthalen-1-yl]ethylidene]-4-hydroxyoxolan-2-one |
|---|---|
| PubChem CID | 157440268 |
| Molecular Formula | C21H30O4 |
| Molecular Weight | 346.47 g/mol |
| Exact Mass | 346.21 |
| IUPAC Name | (3E,4S)-3-[2-[(1R,4aS,5S,8aS)-5-ethyl-5,8a-dimethyl-2-methylidene-6-oxo-1,3,4,4a,7,8-hexahydronaphthalen-1-yl]ethylidene]-4-hydroxyoxolan-2-one |
| SMILES | C=C1CC[C@H]2[C@@](C)(CCC(=O)[C@@]2(C)CC)[C@@H]1C/C=C1/C(=O)OC[C@H]1O |
| InChI | InChI=1S/C21H30O4/c1-5-20(3)17-9-6-13(2)15(21(17,4)11-10-18(20)23)8-7-14-16(22)12-25-19(14)24/h7,15-17,22H,2,5-6,8-12H2,1,3-4H3/b14-7+/t15-,16-,17-,20+,21+/m1/s1 |
| InChIKey | HHUKNATVEZNSKP-YNLBQGDLSA-N |
| XLogP | 3.59 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.47 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|