C29H37NO5 — CID 123652244
3-[2-[4b,10a-dimethyl-2-methylidene-7-(3-nitrophenyl)-3,4,4a,5,6,7,8,8a,9,10-decahydro-1H-phenanthren-1-yl]ethylidene]-4-hydroxyoxolan-2-one (PubChem CID 123652244) has the molecular formula C29H37NO5 and a molecular weight of 479.62 g/mol. Its IUPAC name is 3-[2-[4b,10a-dimethyl-2-methylidene-7-(3-nitrophenyl)-3,4,4a,5,6,7,8,8a,9,10-decahydro-1H-phenanthren-1-yl]ethylidene]-4-hydroxyoxolan-2-one.
| Compound Name | 3-[2-[4b,10a-dimethyl-2-methylidene-7-(3-nitrophenyl)-3,4,4a,5,6,7,8,8a,9,10-decahydro-1H-phenanthren-1-yl]ethylidene]-4-hydroxyoxolan-2-one |
|---|---|
| PubChem CID | 123652244 |
| Molecular Formula | C29H37NO5 |
| Molecular Weight | 479.62 g/mol |
| Exact Mass | 479.27 |
| IUPAC Name | 3-[2-[4b,10a-dimethyl-2-methylidene-7-(3-nitrophenyl)-3,4,4a,5,6,7,8,8a,9,10-decahydro-1H-phenanthren-1-yl]ethylidene]-4-hydroxyoxolan-2-one |
| SMILES | C=C1CCC2C3(C)CCC(c4cccc([N+](=O)[O-])c4)CC3CCC2(C)C1CC=C1C(=O)OCC1O |
| InChI | InChI=1S/C29H37NO5/c1-18-7-10-26-28(2)13-11-20(19-5-4-6-22(16-19)30(33)34)15-21(28)12-14-29(26,3)24(18)9-8-23-25(31)17-35-27(23)32/h4-6,8,16,20-21,24-26,31H,1,7,9-15,17H2,2-3H3 |
| InChIKey | LHTMBARLBGGYJL-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 89.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.62 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|