C27H34O7 — CID 70684868
(3E,4S)-3-[2-[(4aR,6aS,7R,10aS,10bR)-3-(2,4-dihydroxyphenyl)-6a,10b-dimethyl-8-methylidene-1,4a,5,6,7,9,10,10a-octahydronaphtho[2,1-d][1,3]dioxin-7-yl]ethylidene]-4-hydroxyoxolan-2-one (PubChem CID 70684868) has the molecular formula C27H34O7 and a molecular weight of 470.56 g/mol. Its IUPAC name is (3E,4S)-3-[2-[(4aR,6aS,7R,10aS,10bR)-3-(2,4-dihydroxyphenyl)-6a,10b-dimethyl-8-methylidene-1,4a,5,6,7,9,10,10a-octahydronaphtho[2,1-d][1,3]dioxin-7-yl]ethylidene]-4-hydroxyoxolan-2-one.
| Compound Name | (3E,4S)-3-[2-[(4aR,6aS,7R,10aS,10bR)-3-(2,4-dihydroxyphenyl)-6a,10b-dimethyl-8-methylidene-1,4a,5,6,7,9,10,10a-octahydronaphtho[2,1-d][1,3]dioxin-7-yl]ethylidene]-4-hydroxyoxolan-2-one |
|---|---|
| PubChem CID | 70684868 |
| Molecular Formula | C27H34O7 |
| Molecular Weight | 470.56 g/mol |
| Exact Mass | 470.23 |
| IUPAC Name | (3E,4S)-3-[2-[(4aR,6aS,7R,10aS,10bR)-3-(2,4-dihydroxyphenyl)-6a,10b-dimethyl-8-methylidene-1,4a,5,6,7,9,10,10a-octahydronaphtho[2,1-d][1,3]dioxin-7-yl]ethylidene]-4-hydroxyoxolan-2-one |
| SMILES | C=C1CC[C@@H]2[C@]3(C)COC(c4ccc(O)cc4O)O[C@@H]3CC[C@@]2(C)[C@@H]1C/C=C1/C(=O)OC[C@H]1O |
| InChI | InChI=1S/C27H34O7/c1-15-4-9-22-26(2,19(15)8-7-17-21(30)13-32-24(17)31)11-10-23-27(22,3)14-33-25(34-23)18-6-5-16(28)12-20(18)29/h5-7,12,19,21-23,25,28-30H,1,4,8-11,13-14H2,2-3H3/b17-7+/t19-,21-,22+,23-,25?,26+,27+/m1/s1 |
| InChIKey | JKEBLHMVLNPGLV-ZMUYVZAVSA-N |
| XLogP | 4.13 |
| TPSA | 105.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.56 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|