C14H23NO7 — CID 145070017
3-[dihydroxy(morpholin-4-yl)methyl]-6-methylbenzene-1,2,4,5-tetrol;ethane (PubChem CID 145070017) has the molecular formula C14H23NO7 and a molecular weight of 317.34 g/mol. Its IUPAC name is 3-[dihydroxy(morpholin-4-yl)methyl]-6-methylbenzene-1,2,4,5-tetrol;ethane.
| Compound Name | 3-[dihydroxy(morpholin-4-yl)methyl]-6-methylbenzene-1,2,4,5-tetrol;ethane |
|---|---|
| PubChem CID | 145070017 |
| Molecular Formula | C14H23NO7 |
| Molecular Weight | 317.34 g/mol |
| Exact Mass | 317.15 |
| IUPAC Name | 3-[dihydroxy(morpholin-4-yl)methyl]-6-methylbenzene-1,2,4,5-tetrol;ethane |
| SMILES | CC.Cc1c(O)c(O)c(C(O)(O)N2CCOCC2)c(O)c1O |
| InChI | InChI=1S/C12H17NO7.C2H6/c1-6-8(14)10(16)7(11(17)9(6)15)12(18,19)13-2-4-20-5-3-13;1-2/h14-19H,2-5H2,1H3;1-2H3 |
| InChIKey | BCBARHCQFCJOJI-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 133.85 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.34 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|