C11H19FO2 — CID 145071287
(2S,3S,4R)-5-ethyl-3-fluoro-2,3-dimethyl-4-[(E)-prop-1-enoxy]oxolane (PubChem CID 145071287) has the molecular formula C11H19FO2 and a molecular weight of 202.27 g/mol. Its IUPAC name is (2S,3S,4R)-5-ethyl-3-fluoro-2,3-dimethyl-4-[(E)-prop-1-enoxy]oxolane.
| Compound Name | (2S,3S,4R)-5-ethyl-3-fluoro-2,3-dimethyl-4-[(E)-prop-1-enoxy]oxolane |
|---|---|
| PubChem CID | 145071287 |
| Molecular Formula | C11H19FO2 |
| Molecular Weight | 202.27 g/mol |
| Exact Mass | 202.14 |
| IUPAC Name | (2S,3S,4R)-5-ethyl-3-fluoro-2,3-dimethyl-4-[(E)-prop-1-enoxy]oxolane |
| SMILES | C/C=C/O[C@@H]1C(CC)O[C@@H](C)[C@]1(C)F |
| InChI | InChI=1S/C11H19FO2/c1-5-7-13-10-9(6-2)14-8(3)11(10,4)12/h5,7-10H,6H2,1-4H3/b7-5+/t8-,9?,10+,11-/m0/s1 |
| InChIKey | NKKKAKFRKSJRGH-MPULDGLOSA-N |
| XLogP | 2.83 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.27 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|