C11H20O3 — CID 145071313
(2S,3R,4R)-5-ethyl-2,3-dimethyl-4-[(E)-prop-1-enoxy]oxolan-3-ol (PubChem CID 145071313) has the molecular formula C11H20O3 and a molecular weight of 200.28 g/mol. Its IUPAC name is (2S,3R,4R)-5-ethyl-2,3-dimethyl-4-[(E)-prop-1-enoxy]oxolan-3-ol.
| Compound Name | (2S,3R,4R)-5-ethyl-2,3-dimethyl-4-[(E)-prop-1-enoxy]oxolan-3-ol |
|---|---|
| PubChem CID | 145071313 |
| Molecular Formula | C11H20O3 |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.14 |
| IUPAC Name | (2S,3R,4R)-5-ethyl-2,3-dimethyl-4-[(E)-prop-1-enoxy]oxolan-3-ol |
| SMILES | C/C=C/O[C@@H]1C(CC)O[C@@H](C)[C@@]1(C)O |
| InChI | InChI=1S/C11H20O3/c1-5-7-13-10-9(6-2)14-8(3)11(10,4)12/h5,7-10,12H,6H2,1-4H3/b7-5+/t8-,9?,10+,11+/m0/s1 |
| InChIKey | AMOWFRBFPLYBAE-CZXLWHLRSA-N |
| XLogP | 1.85 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|