C56H47BNO3P — CID 145073665
6-[3-diphenylphosphoryl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-10-(2-methylphenyl)-9-(2-phenylphenyl)phenanthridine (PubChem CID 145073665) has the molecular formula C56H47BNO3P and a molecular weight of 823.78 g/mol. Its IUPAC name is 6-[3-diphenylphosphoryl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-10-(2-methylphenyl)-9-(2-phenylphenyl)phenanthridine.
| Compound Name | 6-[3-diphenylphosphoryl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-10-(2-methylphenyl)-9-(2-phenylphenyl)phenanthridine |
|---|---|
| PubChem CID | 145073665 |
| Molecular Formula | C56H47BNO3P |
| Molecular Weight | 823.78 g/mol |
| Exact Mass | 823.34 |
| IUPAC Name | 6-[3-diphenylphosphoryl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-10-(2-methylphenyl)-9-(2-phenylphenyl)phenanthridine |
| SMILES | Cc1ccccc1-c1c(-c2ccccc2-c2ccccc2)ccc2c(-c3cc(B4OC(C)(C)C(C)(C)O4)cc(P(=O)(c4ccccc4)c4ccccc4)c3)nc3ccccc3c12 |
| InChI | InChI=1S/C56H47BNO3P/c1-38-21-15-16-28-45(38)52-48(47-30-18-17-29-46(47)39-22-9-6-10-23-39)33-34-50-53(52)49-31-19-20-32-51(49)58-54(50)40-35-41(57-60-55(2,3)56(4,5)61-57)37-44(36-40)62(59,42-24-11-7-12-25-42)43-26-13-8-14-27-43/h6-37H,1-5H3 |
| InChIKey | RACJXPDNKMXWEW-UHFFFAOYSA-N |
| XLogP | 12.30 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 823.78 |
| LogP ≤ 5 | 12.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|