C29H20F6NOP — CID 134850227
6-bis[4-(trifluoromethyl)phenyl]phosphoryl-2,8-dimethylphenanthridine (PubChem CID 134850227) has the molecular formula C29H20F6NOP and a molecular weight of 543.45 g/mol. Its IUPAC name is 6-bis[4-(trifluoromethyl)phenyl]phosphoryl-2,8-dimethylphenanthridine.
| Compound Name | 6-bis[4-(trifluoromethyl)phenyl]phosphoryl-2,8-dimethylphenanthridine |
|---|---|
| PubChem CID | 134850227 |
| Molecular Formula | C29H20F6NOP |
| Molecular Weight | 543.45 g/mol |
| Exact Mass | 543.12 |
| IUPAC Name | 6-bis[4-(trifluoromethyl)phenyl]phosphoryl-2,8-dimethylphenanthridine |
| SMILES | Cc1ccc2c(c1)c(P(=O)(c1ccc(C(F)(F)F)cc1)c1ccc(C(F)(F)F)cc1)nc1ccc(C)cc12 |
| InChI | InChI=1S/C29H20F6NOP/c1-17-3-13-23-24-15-18(2)4-14-26(24)36-27(25(23)16-17)38(37,21-9-5-19(6-10-21)28(30,31)32)22-11-7-20(8-12-22)29(33,34)35/h3-16H,1-2H3 |
| InChIKey | IDJSVNUKJQQJLS-UHFFFAOYSA-N |
| XLogP | 7.68 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.45 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|