C40H25F9O3P2 — CID 88865185
2-bis[4-(trifluoromethyl)phenyl]phosphoryl-8-[(4-methylphenyl)-[4-(trifluoromethyl)phenyl]phosphoryl]dibenzofuran (PubChem CID 88865185) has the molecular formula C40H25F9O3P2 and a molecular weight of 786.57 g/mol. Its IUPAC name is 2-bis[4-(trifluoromethyl)phenyl]phosphoryl-8-[(4-methylphenyl)-[4-(trifluoromethyl)phenyl]phosphoryl]dibenzofuran.
| Compound Name | 2-bis[4-(trifluoromethyl)phenyl]phosphoryl-8-[(4-methylphenyl)-[4-(trifluoromethyl)phenyl]phosphoryl]dibenzofuran |
|---|---|
| PubChem CID | 88865185 |
| Molecular Formula | C40H25F9O3P2 |
| Molecular Weight | 786.57 g/mol |
| Exact Mass | 786.11 |
| IUPAC Name | 2-bis[4-(trifluoromethyl)phenyl]phosphoryl-8-[(4-methylphenyl)-[4-(trifluoromethyl)phenyl]phosphoryl]dibenzofuran |
| SMILES | Cc1ccc(P(=O)(c2ccc(C(F)(F)F)cc2)c2ccc3oc4ccc(P(=O)(c5ccc(C(F)(F)F)cc5)c5ccc(C(F)(F)F)cc5)cc4c3c2)cc1 |
| InChI | InChI=1S/C40H25F9O3P2/c1-24-2-10-28(11-3-24)53(50,29-12-4-25(5-13-29)38(41,42)43)32-18-20-36-34(22-32)35-23-33(19-21-37(35)52-36)54(51,30-14-6-26(7-15-30)39(44,45)46)31-16-8-27(9-17-31)40(47,48)49/h2-23H,1H3 |
| InChIKey | XUDQZZCQHUIVNT-UHFFFAOYSA-N |
| XLogP | 10.23 |
| TPSA | 47.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 786.57 |
| LogP ≤ 5 | 10.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|