C42H30F6O2P2 — CID 88865175
2-bis(4-methylphenyl)phosphoryl-7-bis[4-(trifluoromethyl)phenyl]phosphorylphenanthrene (PubChem CID 88865175) has the molecular formula C42H30F6O2P2 and a molecular weight of 742.64 g/mol. Its IUPAC name is 2-bis(4-methylphenyl)phosphoryl-7-bis[4-(trifluoromethyl)phenyl]phosphorylphenanthrene.
| Compound Name | 2-bis(4-methylphenyl)phosphoryl-7-bis[4-(trifluoromethyl)phenyl]phosphorylphenanthrene |
|---|---|
| PubChem CID | 88865175 |
| Molecular Formula | C42H30F6O2P2 |
| Molecular Weight | 742.64 g/mol |
| Exact Mass | 742.16 |
| IUPAC Name | 2-bis(4-methylphenyl)phosphoryl-7-bis[4-(trifluoromethyl)phenyl]phosphorylphenanthrene |
| SMILES | Cc1ccc(P(=O)(c2ccc(C)cc2)c2ccc3c(ccc4cc(P(=O)(c5ccc(C(F)(F)F)cc5)c5ccc(C(F)(F)F)cc5)ccc43)c2)cc1 |
| InChI | InChI=1S/C42H30F6O2P2/c1-27-3-13-33(14-4-27)51(49,34-15-5-28(2)6-16-34)37-21-23-39-29(25-37)7-8-30-26-38(22-24-40(30)39)52(50,35-17-9-31(10-18-35)41(43,44)45)36-19-11-32(12-20-36)42(46,47)48/h3-26H,1-2H3 |
| InChIKey | WNPTUCTUEPXDKH-UHFFFAOYSA-N |
| XLogP | 9.93 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 742.64 |
| LogP ≤ 5 | 9.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|