C17H23N3 — CID 145073833
ethane;5-[(3E)-hexa-1,3-dien-3-yl]-1,6-diazabicyclo[5.4.0]undeca-6,8,10-trien-3-yn-2-amine (PubChem CID 145073833) has the molecular formula C17H23N3 and a molecular weight of 269.39 g/mol. Its IUPAC name is ethane;5-[(3E)-hexa-1,3-dien-3-yl]-1,6-diazabicyclo[5.4.0]undeca-6,8,10-trien-3-yn-2-amine.
| Compound Name | ethane;5-[(3E)-hexa-1,3-dien-3-yl]-1,6-diazabicyclo[5.4.0]undeca-6,8,10-trien-3-yn-2-amine |
|---|---|
| PubChem CID | 145073833 |
| Molecular Formula | C17H23N3 |
| Molecular Weight | 269.39 g/mol |
| Exact Mass | 269.19 |
| IUPAC Name | ethane;5-[(3E)-hexa-1,3-dien-3-yl]-1,6-diazabicyclo[5.4.0]undeca-6,8,10-trien-3-yn-2-amine |
| SMILES | C=C/C(=C\CC)C1C#CC(N)N2C=CC=CC2=N1.CC |
| InChI | InChI=1S/C15H17N3.C2H6/c1-3-7-12(4-2)13-9-10-14(16)18-11-6-5-8-15(18)17-13;1-2/h4-8,11,13-14H,2-3,16H2,1H3;1-2H3/b12-7+; |
| InChIKey | YLNJQQSCXMQVOU-RRAJOLSVSA-N |
| XLogP | 2.99 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.39 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|