C12H24N2 — CID 145074380
ethane;(Z)-2-(6-methylpiperidin-3-yl)but-2-en-1-imine (PubChem CID 145074380) has the molecular formula C12H24N2 and a molecular weight of 196.34 g/mol. Its IUPAC name is ethane;(Z)-2-(6-methylpiperidin-3-yl)but-2-en-1-imine.
| Compound Name | ethane;(Z)-2-(6-methylpiperidin-3-yl)but-2-en-1-imine |
|---|---|
| PubChem CID | 145074380 |
| Molecular Formula | C12H24N2 |
| Molecular Weight | 196.34 g/mol |
| Exact Mass | 196.19 |
| IUPAC Name | ethane;(Z)-2-(6-methylpiperidin-3-yl)but-2-en-1-imine |
| SMILES | CC.[H]/N=C/C(=C\C)C1CCC(C)NC1 |
| InChI | InChI=1S/C10H18N2.C2H6/c1-3-9(6-11)10-5-4-8(2)12-7-10;1-2/h3,6,8,10-12H,4-5,7H2,1-2H3;1-2H3/b9-3+,11-6+; |
| InChIKey | FXKMJSFDHYLBLQ-JWSZLVFPSA-N |
| XLogP | 3.00 |
| TPSA | 35.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.34 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|