C21H19ClF2N2O2 — CID 145074617
ethyl 1-(2-chloro-4-methylphenyl)-6,7-difluoro-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carboxylate (PubChem CID 145074617) has the molecular formula C21H19ClF2N2O2 and a molecular weight of 404.84 g/mol. Its IUPAC name is ethyl 1-(2-chloro-4-methylphenyl)-6,7-difluoro-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carboxylate.
| Compound Name | ethyl 1-(2-chloro-4-methylphenyl)-6,7-difluoro-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carboxylate |
|---|---|
| PubChem CID | 145074617 |
| Molecular Formula | C21H19ClF2N2O2 |
| Molecular Weight | 404.84 g/mol |
| Exact Mass | 404.11 |
| IUPAC Name | ethyl 1-(2-chloro-4-methylphenyl)-6,7-difluoro-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carboxylate |
| SMILES | CCOC(=O)C1Cc2c([nH]c3cc(F)c(F)cc23)C(c2ccc(C)cc2Cl)N1 |
| InChI | InChI=1S/C21H19ClF2N2O2/c1-3-28-21(27)18-8-13-12-7-15(23)16(24)9-17(12)25-20(13)19(26-18)11-5-4-10(2)6-14(11)22/h4-7,9,18-19,25-26H,3,8H2,1-2H3 |
| InChIKey | DSQAZQMERCXVOU-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 54.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.84 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|