C10H16N2 — CID 145076280
1-(2,3,4-trimethyl-5-methylidene-2H-pyrrol-1-yl)ethanimine (PubChem CID 145076280) has the molecular formula C10H16N2 and a molecular weight of 164.25 g/mol. Its IUPAC name is 1-(2,3,4-trimethyl-5-methylidene-2H-pyrrol-1-yl)ethanimine.
| Compound Name | 1-(2,3,4-trimethyl-5-methylidene-2H-pyrrol-1-yl)ethanimine |
|---|---|
| PubChem CID | 145076280 |
| Molecular Formula | C10H16N2 |
| Molecular Weight | 164.25 g/mol |
| Exact Mass | 164.13 |
| IUPAC Name | 1-(2,3,4-trimethyl-5-methylidene-2H-pyrrol-1-yl)ethanimine |
| SMILES | [H]/N=C(\C)N1C(=C)C(C)=C(C)C1C |
| InChI | InChI=1S/C10H16N2/c1-6-7(2)9(4)12(8(6)3)10(5)11/h9,11H,3H2,1-2,4-5H3/b11-10+ |
| InChIKey | TZHXJIXVCOOQBP-ZHACJKMWSA-N |
| XLogP | 2.54 |
| TPSA | 27.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.25 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|