C24H35ClN2O — CID 145078476
4-chloro-N-[[4-(2-methyl-4-pyridinyl)cyclohexyl]methyl]benzamide;ethane (PubChem CID 145078476) has the molecular formula C24H35ClN2O and a molecular weight of 403.01 g/mol. Its IUPAC name is 4-chloro-N-[[4-(2-methyl-4-pyridinyl)cyclohexyl]methyl]benzamide;ethane.
| Compound Name | 4-chloro-N-[[4-(2-methyl-4-pyridinyl)cyclohexyl]methyl]benzamide;ethane |
|---|---|
| PubChem CID | 145078476 |
| Molecular Formula | C24H35ClN2O |
| Molecular Weight | 403.01 g/mol |
| Exact Mass | 402.24 |
| IUPAC Name | 4-chloro-N-[[4-(2-methyl-4-pyridinyl)cyclohexyl]methyl]benzamide;ethane |
| SMILES | CC.CC.Cc1cc(C2CCC(CNC(=O)c3ccc(Cl)cc3)CC2)ccn1 |
| InChI | InChI=1S/C20H23ClN2O.2C2H6/c1-14-12-18(10-11-22-14)16-4-2-15(3-5-16)13-23-20(24)17-6-8-19(21)9-7-17;2*1-2/h6-12,15-16H,2-5,13H2,1H3,(H,23,24);2*1-2H3 |
| InChIKey | GONPGMHQSZOEBV-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.01 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |