C20H30ClN3O3 — CID 68875804
4-chloro-N-[[4-[(3-methoxypropylcarbamoylamino)methyl]cyclohexyl]methyl]benzamide (PubChem CID 68875804) has the molecular formula C20H30ClN3O3 and a molecular weight of 395.93 g/mol. Its IUPAC name is 4-chloro-N-[[4-[(3-methoxypropylcarbamoylamino)methyl]cyclohexyl]methyl]benzamide.
| Compound Name | 4-chloro-N-[[4-[(3-methoxypropylcarbamoylamino)methyl]cyclohexyl]methyl]benzamide |
|---|---|
| PubChem CID | 68875804 |
| Molecular Formula | C20H30ClN3O3 |
| Molecular Weight | 395.93 g/mol |
| Exact Mass | 395.20 |
| IUPAC Name | 4-chloro-N-[[4-[(3-methoxypropylcarbamoylamino)methyl]cyclohexyl]methyl]benzamide |
| SMILES | COCCCNC(=O)NCC1CCC(CNC(=O)c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C20H30ClN3O3/c1-27-12-2-11-22-20(26)24-14-16-5-3-15(4-6-16)13-23-19(25)17-7-9-18(21)10-8-17/h7-10,15-16H,2-6,11-14H2,1H3,(H,23,25)(H2,22,24,26) |
| InChIKey | AAVMDDYVYBRODB-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.93 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|