C15H21ClN2O3 — CID 99829031
1-[2-(4-chlorophenoxy)ethyl]-3-[[(1S,3R)-3-hydroxycyclopentyl]methyl]urea (PubChem CID 99829031) has the molecular formula C15H21ClN2O3 and a molecular weight of 312.80 g/mol. Its IUPAC name is 1-[2-(4-chlorophenoxy)ethyl]-3-[[(1S,3R)-3-hydroxycyclopentyl]methyl]urea.
| Compound Name | 1-[2-(4-chlorophenoxy)ethyl]-3-[[(1S,3R)-3-hydroxycyclopentyl]methyl]urea |
|---|---|
| PubChem CID | 99829031 |
| Molecular Formula | C15H21ClN2O3 |
| Molecular Weight | 312.80 g/mol |
| Exact Mass | 312.12 |
| IUPAC Name | 1-[2-(4-chlorophenoxy)ethyl]-3-[[(1S,3R)-3-hydroxycyclopentyl]methyl]urea |
| SMILES | O=C(NCCOc1ccc(Cl)cc1)NC[C@H]1CC[C@@H](O)C1 |
| InChI | InChI=1S/C15H21ClN2O3/c16-12-2-5-14(6-3-12)21-8-7-17-15(20)18-10-11-1-4-13(19)9-11/h2-3,5-6,11,13,19H,1,4,7-10H2,(H2,17,18,20)/t11-,13+/m0/s1 |
| InChIKey | OOCDZPHIKNMPOU-WCQYABFASA-N |
| XLogP | 2.18 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.80 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|