C14H18ClNO3 — CID 141050189
(4-chlorophenyl) N-[(4-hydroxycyclohexyl)methyl]carbamate (PubChem CID 141050189) has the molecular formula C14H18ClNO3 and a molecular weight of 283.75 g/mol. Its IUPAC name is (4-chlorophenyl) N-[(4-hydroxycyclohexyl)methyl]carbamate.
| Compound Name | (4-chlorophenyl) N-[(4-hydroxycyclohexyl)methyl]carbamate |
|---|---|
| PubChem CID | 141050189 |
| Molecular Formula | C14H18ClNO3 |
| Molecular Weight | 283.75 g/mol |
| Exact Mass | 283.10 |
| IUPAC Name | (4-chlorophenyl) N-[(4-hydroxycyclohexyl)methyl]carbamate |
| SMILES | O=C(NCC1CCC(O)CC1)Oc1ccc(Cl)cc1 |
| InChI | InChI=1S/C14H18ClNO3/c15-11-3-7-13(8-4-11)19-14(18)16-9-10-1-5-12(17)6-2-10/h3-4,7-8,10,12,17H,1-2,5-6,9H2,(H,16,18) |
| InChIKey | SEHSYXFOHFRQSR-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.75 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |