C19H14S — CID 145078987
1-cyclohepta-1,4,6-trien-1-yldibenzothiophene (PubChem CID 145078987) has the molecular formula C19H14S and a molecular weight of 274.39 g/mol. Its IUPAC name is 1-cyclohepta-1,4,6-trien-1-yldibenzothiophene.
| Compound Name | 1-cyclohepta-1,4,6-trien-1-yldibenzothiophene |
|---|---|
| PubChem CID | 145078987 |
| Molecular Formula | C19H14S |
| Molecular Weight | 274.39 g/mol |
| Exact Mass | 274.08 |
| IUPAC Name | 1-cyclohepta-1,4,6-trien-1-yldibenzothiophene |
| SMILES | C1=CCC=C(c2cccc3sc4ccccc4c23)C=C1 |
| InChI | InChI=1S/C19H14S/c1-2-4-9-14(8-3-1)15-11-7-13-18-19(15)16-10-5-6-12-17(16)20-18/h1-3,5-13H,4H2 |
| InChIKey | CZYXLLAYCAXWGS-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.39 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |