C12H16N2O4 — CID 145080862
ethyl (2S,4R,5S)-5-(methoxymethoxy)-7,8-diazatricyclo[4.3.0.02,4]nona-1(6),8-diene-9-carboxylate (PubChem CID 145080862) has the molecular formula C12H16N2O4 and a molecular weight of 252.27 g/mol. Its IUPAC name is ethyl (2S,4R,5S)-5-(methoxymethoxy)-7,8-diazatricyclo[4.3.0.02,4]nona-1(6),8-diene-9-carboxylate.
| Compound Name | ethyl (2S,4R,5S)-5-(methoxymethoxy)-7,8-diazatricyclo[4.3.0.02,4]nona-1(6),8-diene-9-carboxylate |
|---|---|
| PubChem CID | 145080862 |
| Molecular Formula | C12H16N2O4 |
| Molecular Weight | 252.27 g/mol |
| Exact Mass | 252.11 |
| IUPAC Name | ethyl (2S,4R,5S)-5-(methoxymethoxy)-7,8-diazatricyclo[4.3.0.02,4]nona-1(6),8-diene-9-carboxylate |
| SMILES | CCOC(=O)c1n[nH]c2c1[C@H]1C[C@H]1[C@@H]2OCOC |
| InChI | InChI=1S/C12H16N2O4/c1-3-17-12(15)10-8-6-4-7(6)11(18-5-16-2)9(8)13-14-10/h6-7,11H,3-5H2,1-2H3,(H,13,14)/t6-,7+,11-/m0/s1 |
| InChIKey | NZYLFVZBDOSTTK-CVJICSNFSA-N |
| XLogP | 1.37 |
| TPSA | 73.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.27 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|